C45H58N2O8 — CID 139787549
tert-butyl 3-[4-(oxan-2-yloxy)butoxy]-4-[4-(3-phenylmethoxypropoxy)phenyl]-5-(quinolin-7-ylmethoxy)piperidine-1-carboxylate (PubChem CID 139787549) has the molecular formula C45H58N2O8 and a molecular weight of 754.96 g/mol. Its IUPAC name is tert-butyl 3-[4-(oxan-2-yloxy)butoxy]-4-[4-(3-phenylmethoxypropoxy)phenyl]-5-(quinolin-7-ylmethoxy)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-(oxan-2-yloxy)butoxy]-4-[4-(3-phenylmethoxypropoxy)phenyl]-5-(quinolin-7-ylmethoxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 139787549 |
| Molecular Formula | C45H58N2O8 |
| Molecular Weight | 754.96 g/mol |
| Exact Mass | 754.42 |
| IUPAC Name | tert-butyl 3-[4-(oxan-2-yloxy)butoxy]-4-[4-(3-phenylmethoxypropoxy)phenyl]-5-(quinolin-7-ylmethoxy)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(OCCCCOC2CCCCO2)C(c2ccc(OCCCOCc3ccccc3)cc2)C(OCc2ccc3cccnc3c2)C1 |
| InChI | InChI=1S/C45H58N2O8/c1-45(2,3)55-44(48)47-30-40(51-25-9-10-27-53-42-16-7-8-26-52-42)43(41(31-47)54-33-35-17-18-36-15-11-23-46-39(36)29-35)37-19-21-38(22-20-37)50-28-12-24-49-32-34-13-5-4-6-14-34/h4-6,11,13-15,17-23,29,40-43H,7-10,12,16,24-28,30-33H2,1-3H3 |
| InChIKey | QGWOTOXJFWNLCV-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 97.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.96 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|