C43H54N2O8 — CID 139787562
tert-butyl 3-[2-(oxan-2-yloxy)ethoxy]-4-[4-(3-phenylmethoxypropoxy)phenyl]-5-(quinolin-7-ylmethoxy)piperidine-1-carboxylate (PubChem CID 139787562) has the molecular formula C43H54N2O8 and a molecular weight of 726.91 g/mol. Its IUPAC name is tert-butyl 3-[2-(oxan-2-yloxy)ethoxy]-4-[4-(3-phenylmethoxypropoxy)phenyl]-5-(quinolin-7-ylmethoxy)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-(oxan-2-yloxy)ethoxy]-4-[4-(3-phenylmethoxypropoxy)phenyl]-5-(quinolin-7-ylmethoxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 139787562 |
| Molecular Formula | C43H54N2O8 |
| Molecular Weight | 726.91 g/mol |
| Exact Mass | 726.39 |
| IUPAC Name | tert-butyl 3-[2-(oxan-2-yloxy)ethoxy]-4-[4-(3-phenylmethoxypropoxy)phenyl]-5-(quinolin-7-ylmethoxy)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(OCCOC2CCCCO2)C(c2ccc(OCCCOCc3ccccc3)cc2)C(OCc2ccc3cccnc3c2)C1 |
| InChI | InChI=1S/C43H54N2O8/c1-43(2,3)53-42(46)45-28-38(49-25-26-51-40-14-7-8-23-50-40)41(39(29-45)52-31-33-15-16-34-13-9-21-44-37(34)27-33)35-17-19-36(20-18-35)48-24-10-22-47-30-32-11-5-4-6-12-32/h4-6,9,11-13,15-21,27,38-41H,7-8,10,14,22-26,28-31H2,1-3H3 |
| InChIKey | QMRRXAJVEDJAPB-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 97.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.91 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|