C36H35Cl4NO6 — CID 22128250
3,5-bis[(3,5-dichlorophenyl)methoxy]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine-1-carboxylic acid (PubChem CID 22128250) has the molecular formula C36H35Cl4NO6 and a molecular weight of 719.49 g/mol. Its IUPAC name is 3,5-bis[(3,5-dichlorophenyl)methoxy]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine-1-carboxylic acid.
| Compound Name | 3,5-bis[(3,5-dichlorophenyl)methoxy]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 22128250 |
| Molecular Formula | C36H35Cl4NO6 |
| Molecular Weight | 719.49 g/mol |
| Exact Mass | 717.12 |
| IUPAC Name | 3,5-bis[(3,5-dichlorophenyl)methoxy]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CC(OCc2cc(Cl)cc(Cl)c2)C(c2ccc(OCCCOCc3ccccc3)cc2)C(OCc2cc(Cl)cc(Cl)c2)C1 |
| InChI | InChI=1S/C36H35Cl4NO6/c37-28-13-25(14-29(38)17-28)22-46-33-19-41(36(42)43)20-34(47-23-26-15-30(39)18-31(40)16-26)35(33)27-7-9-32(10-8-27)45-12-4-11-44-21-24-5-2-1-3-6-24/h1-3,5-10,13-18,33-35H,4,11-12,19-23H2,(H,42,43) |
| InChIKey | FDEGXLJYMSRMOS-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.49 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|