C42H51Cl2NO10 — CID 57301032
(3R,5S)-1-(dichloromethyl)-4-[4-(3-phenylmethoxypropoxy)phenyl]-3,5-bis[(3,4,5-trimethoxyphenyl)methoxy]piperidine (PubChem CID 57301032) has the molecular formula C42H51Cl2NO10 and a molecular weight of 800.77 g/mol. Its IUPAC name is (3R,5S)-1-(dichloromethyl)-4-[4-(3-phenylmethoxypropoxy)phenyl]-3,5-bis[(3,4,5-trimethoxyphenyl)methoxy]piperidine.
| Compound Name | (3R,5S)-1-(dichloromethyl)-4-[4-(3-phenylmethoxypropoxy)phenyl]-3,5-bis[(3,4,5-trimethoxyphenyl)methoxy]piperidine |
|---|---|
| PubChem CID | 57301032 |
| Molecular Formula | C42H51Cl2NO10 |
| Molecular Weight | 800.77 g/mol |
| Exact Mass | 799.29 |
| IUPAC Name | (3R,5S)-1-(dichloromethyl)-4-[4-(3-phenylmethoxypropoxy)phenyl]-3,5-bis[(3,4,5-trimethoxyphenyl)methoxy]piperidine |
| SMILES | COc1cc(CO[C@H]2CN(C(Cl)Cl)C[C@@H](OCc3cc(OC)c(OC)c(OC)c3)C2c2ccc(OCCCOCc3ccccc3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C42H51Cl2NO10/c1-46-33-19-29(20-34(47-2)40(33)50-5)26-54-37-23-45(42(43)44)24-38(55-27-30-21-35(48-3)41(51-6)36(22-30)49-4)39(37)31-13-15-32(16-14-31)53-18-10-17-52-25-28-11-8-7-9-12-28/h7-9,11-16,19-22,37-39,42H,10,17-18,23-27H2,1-6H3/t37-,38+,39? |
| InChIKey | VOVHSPFWOBKAGN-XPOQJEQISA-N |
| XLogP | 8.06 |
| TPSA | 95.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.77 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|