C28H32Cl3NO4 — CID 22127768
5-[(3,5-dichlorophenyl)methoxy]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidin-3-ol;hydrochloride (PubChem CID 22127768) has the molecular formula C28H32Cl3NO4 and a molecular weight of 552.93 g/mol. Its IUPAC name is 5-[(3,5-dichlorophenyl)methoxy]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidin-3-ol;hydrochloride.
| Compound Name | 5-[(3,5-dichlorophenyl)methoxy]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidin-3-ol;hydrochloride |
|---|---|
| PubChem CID | 22127768 |
| Molecular Formula | C28H32Cl3NO4 |
| Molecular Weight | 552.93 g/mol |
| Exact Mass | 551.14 |
| IUPAC Name | 5-[(3,5-dichlorophenyl)methoxy]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidin-3-ol;hydrochloride |
| SMILES | Cl.OC1CNCC(OCc2cc(Cl)cc(Cl)c2)C1c1ccc(OCCCOCc2ccccc2)cc1 |
| InChI | InChI=1S/C28H31Cl2NO4.ClH/c29-23-13-21(14-24(30)15-23)19-35-27-17-31-16-26(32)28(27)22-7-9-25(10-8-22)34-12-4-11-33-18-20-5-2-1-3-6-20;/h1-3,5-10,13-15,26-28,31-32H,4,11-12,16-19H2;1H |
| InChIKey | AVGXSKVXQCQWBQ-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.93 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|