C34H39NO4 — CID 57217168
(3S,4R,5R)-3-(methoxymethyl)-5-(naphthalen-2-ylmethoxy)-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine (PubChem CID 57217168) has the molecular formula C34H39NO4 and a molecular weight of 525.69 g/mol. Its IUPAC name is (3S,4R,5R)-3-(methoxymethyl)-5-(naphthalen-2-ylmethoxy)-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine.
| Compound Name | (3S,4R,5R)-3-(methoxymethyl)-5-(naphthalen-2-ylmethoxy)-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine |
|---|---|
| PubChem CID | 57217168 |
| Molecular Formula | C34H39NO4 |
| Molecular Weight | 525.69 g/mol |
| Exact Mass | 525.29 |
| IUPAC Name | (3S,4R,5R)-3-(methoxymethyl)-5-(naphthalen-2-ylmethoxy)-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine |
| SMILES | COC[C@@H]1CNC[C@H](OCc2ccc3ccccc3c2)[C@H]1c1ccc(OCCCOCc2ccccc2)cc1 |
| InChI | InChI=1S/C34H39NO4/c1-36-25-31-21-35-22-33(39-24-27-12-13-28-10-5-6-11-30(28)20-27)34(31)29-14-16-32(17-15-29)38-19-7-18-37-23-26-8-3-2-4-9-26/h2-6,8-17,20,31,33-35H,7,18-19,21-25H2,1H3/t31-,33-,34-/m0/s1 |
| InChIKey | WUAIVTZASDYIOE-XLDNGHKCSA-N |
| XLogP | 6.36 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.69 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|