C53H50NO6- — CID 22126882
3-(naphthalen-2-ylmethoxy)-4-[4-(3-phenylmethoxypropoxy)phenyl]-5-(trityloxymethyl)piperidine-1-carboxylate (PubChem CID 22126882) has the molecular formula C53H50NO6- and a molecular weight of 796.98 g/mol. Its IUPAC name is 3-(naphthalen-2-ylmethoxy)-4-[4-(3-phenylmethoxypropoxy)phenyl]-5-(trityloxymethyl)piperidine-1-carboxylate.
| Compound Name | 3-(naphthalen-2-ylmethoxy)-4-[4-(3-phenylmethoxypropoxy)phenyl]-5-(trityloxymethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 22126882 |
| Molecular Formula | C53H50NO6- |
| Molecular Weight | 796.98 g/mol |
| Exact Mass | 796.36 |
| IUPAC Name | 3-(naphthalen-2-ylmethoxy)-4-[4-(3-phenylmethoxypropoxy)phenyl]-5-(trityloxymethyl)piperidine-1-carboxylate |
| SMILES | O=C([O-])N1CC(COC(c2ccccc2)(c2ccccc2)c2ccccc2)C(c2ccc(OCCCOCc3ccccc3)cc2)C(OCc2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C53H51NO6/c55-52(56)54-35-45(39-60-53(46-20-7-2-8-21-46,47-22-9-3-10-23-47)48-24-11-4-12-25-48)51(50(36-54)59-38-41-26-27-42-18-13-14-19-44(42)34-41)43-28-30-49(31-29-43)58-33-15-32-57-37-40-16-5-1-6-17-40/h1-14,16-31,34,45,50-51H,15,32-33,35-39H2,(H,55,56)/p-1 |
| InChIKey | PFGYRNRTULYSMH-UHFFFAOYSA-M |
| XLogP | 9.78 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.98 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|