C31H36NO6- — CID 22128293
3-[(4-ethylphenyl)methoxy]-5-hydroxy-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine-1-carboxylate (PubChem CID 22128293) has the molecular formula C31H36NO6- and a molecular weight of 518.63 g/mol. Its IUPAC name is 3-[(4-ethylphenyl)methoxy]-5-hydroxy-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine-1-carboxylate.
| Compound Name | 3-[(4-ethylphenyl)methoxy]-5-hydroxy-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 22128293 |
| Molecular Formula | C31H36NO6- |
| Molecular Weight | 518.63 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | 3-[(4-ethylphenyl)methoxy]-5-hydroxy-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine-1-carboxylate |
| SMILES | CCc1ccc(COC2CN(C(=O)[O-])CC(O)C2c2ccc(OCCCOCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C31H37NO6/c1-2-23-9-11-25(12-10-23)22-38-29-20-32(31(34)35)19-28(33)30(29)26-13-15-27(16-14-26)37-18-6-17-36-21-24-7-4-3-5-8-24/h3-5,7-16,28-30,33H,2,6,17-22H2,1H3,(H,34,35)/p-1 |
| InChIKey | HRJPKZHROMIJET-UHFFFAOYSA-M |
| XLogP | 3.92 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.63 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|