C31H37Cl2NO3 — CID 57000015
1-(dichloromethyl)-3-[(4-ethylphenyl)methoxy]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine (PubChem CID 57000015) has the molecular formula C31H37Cl2NO3 and a molecular weight of 542.55 g/mol. Its IUPAC name is 1-(dichloromethyl)-3-[(4-ethylphenyl)methoxy]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine.
| Compound Name | 1-(dichloromethyl)-3-[(4-ethylphenyl)methoxy]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine |
|---|---|
| PubChem CID | 57000015 |
| Molecular Formula | C31H37Cl2NO3 |
| Molecular Weight | 542.55 g/mol |
| Exact Mass | 541.22 |
| IUPAC Name | 1-(dichloromethyl)-3-[(4-ethylphenyl)methoxy]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine |
| SMILES | CCc1ccc(COC2CN(C(Cl)Cl)CCC2c2ccc(OCCCOCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C31H37Cl2NO3/c1-2-24-9-11-26(12-10-24)23-37-30-21-34(31(32)33)18-17-29(30)27-13-15-28(16-14-27)36-20-6-19-35-22-25-7-4-3-5-8-25/h3-5,7-16,29-31H,2,6,17-23H2,1H3 |
| InChIKey | IOWMTABTBXVJRX-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.55 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|