C35H39Cl2NO4S — CID 90943588
4-[4-(3-benzylsulfanylpropoxy)phenyl]-1-(dichloromethyl)-3-[(1,4-dimethoxynaphthalen-2-yl)methoxy]piperidine (PubChem CID 90943588) has the molecular formula C35H39Cl2NO4S and a molecular weight of 640.67 g/mol. Its IUPAC name is 4-[4-(3-benzylsulfanylpropoxy)phenyl]-1-(dichloromethyl)-3-[(1,4-dimethoxynaphthalen-2-yl)methoxy]piperidine.
| Compound Name | 4-[4-(3-benzylsulfanylpropoxy)phenyl]-1-(dichloromethyl)-3-[(1,4-dimethoxynaphthalen-2-yl)methoxy]piperidine |
|---|---|
| PubChem CID | 90943588 |
| Molecular Formula | C35H39Cl2NO4S |
| Molecular Weight | 640.67 g/mol |
| Exact Mass | 639.20 |
| IUPAC Name | 4-[4-(3-benzylsulfanylpropoxy)phenyl]-1-(dichloromethyl)-3-[(1,4-dimethoxynaphthalen-2-yl)methoxy]piperidine |
| SMILES | COc1cc(COC2CN(C(Cl)Cl)CCC2c2ccc(OCCCSCc3ccccc3)cc2)c(OC)c2ccccc12 |
| InChI | InChI=1S/C35H39Cl2NO4S/c1-39-32-21-27(34(40-2)31-12-7-6-11-30(31)32)23-42-33-22-38(35(36)37)18-17-29(33)26-13-15-28(16-14-26)41-19-8-20-43-24-25-9-4-3-5-10-25/h3-7,9-16,21,29,33,35H,8,17-20,22-24H2,1-2H3 |
| InChIKey | JVZJFEVCBQUZSZ-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.67 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|