C28H30NO6- — CID 22128811
3-[(1,4-dimethoxynaphthalen-2-yl)methoxy]-4-(4-prop-2-enoxyphenyl)piperidine-1-carboxylate (PubChem CID 22128811) has the molecular formula C28H30NO6- and a molecular weight of 476.55 g/mol. Its IUPAC name is 3-[(1,4-dimethoxynaphthalen-2-yl)methoxy]-4-(4-prop-2-enoxyphenyl)piperidine-1-carboxylate.
| Compound Name | 3-[(1,4-dimethoxynaphthalen-2-yl)methoxy]-4-(4-prop-2-enoxyphenyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 22128811 |
| Molecular Formula | C28H30NO6- |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 3-[(1,4-dimethoxynaphthalen-2-yl)methoxy]-4-(4-prop-2-enoxyphenyl)piperidine-1-carboxylate |
| SMILES | C=CCOc1ccc(C2CCN(C(=O)[O-])CC2OCc2cc(OC)c3ccccc3c2OC)cc1 |
| InChI | InChI=1S/C28H31NO6/c1-4-15-34-21-11-9-19(10-12-21)22-13-14-29(28(30)31)17-26(22)35-18-20-16-25(32-2)23-7-5-6-8-24(23)27(20)33-3/h4-12,16,22,26H,1,13-15,17-18H2,2-3H3,(H,30,31)/p-1 |
| InChIKey | YGSUXRIWHQUNGC-UHFFFAOYSA-M |
| XLogP | 4.14 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|