C39H47NO8 — CID 91322053
tert-butyl 3-[(1,4-dimethoxynaphthalen-2-yl)methoxy]-4-[4-[3-(3-methoxyphenoxy)propoxy]phenyl]piperidine-1-carboxylate (PubChem CID 91322053) has the molecular formula C39H47NO8 and a molecular weight of 657.80 g/mol. Its IUPAC name is tert-butyl 3-[(1,4-dimethoxynaphthalen-2-yl)methoxy]-4-[4-[3-(3-methoxyphenoxy)propoxy]phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(1,4-dimethoxynaphthalen-2-yl)methoxy]-4-[4-[3-(3-methoxyphenoxy)propoxy]phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 91322053 |
| Molecular Formula | C39H47NO8 |
| Molecular Weight | 657.80 g/mol |
| Exact Mass | 657.33 |
| IUPAC Name | tert-butyl 3-[(1,4-dimethoxynaphthalen-2-yl)methoxy]-4-[4-[3-(3-methoxyphenoxy)propoxy]phenyl]piperidine-1-carboxylate |
| SMILES | COc1cccc(OCCCOc2ccc(C3CCN(C(=O)OC(C)(C)C)CC3OCc3cc(OC)c4ccccc4c3OC)cc2)c1 |
| InChI | InChI=1S/C39H47NO8/c1-39(2,3)48-38(41)40-20-19-32(27-15-17-29(18-16-27)45-21-10-22-46-31-12-9-11-30(24-31)42-4)36(25-40)47-26-28-23-35(43-5)33-13-7-8-14-34(33)37(28)44-6/h7-9,11-18,23-24,32,36H,10,19-22,25-26H2,1-6H3 |
| InChIKey | JADVOFUKVBBLAT-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 84.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.80 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|