C39H45NO6 — CID 54164264
tert-butyl 3-[(1,4-dimethoxynaphthalen-2-yl)methoxy]-4-[4-(4-phenylbut-3-enoxy)phenyl]piperidine-1-carboxylate (PubChem CID 54164264) has the molecular formula C39H45NO6 and a molecular weight of 623.79 g/mol. Its IUPAC name is tert-butyl 3-[(1,4-dimethoxynaphthalen-2-yl)methoxy]-4-[4-(4-phenylbut-3-enoxy)phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(1,4-dimethoxynaphthalen-2-yl)methoxy]-4-[4-(4-phenylbut-3-enoxy)phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 54164264 |
| Molecular Formula | C39H45NO6 |
| Molecular Weight | 623.79 g/mol |
| Exact Mass | 623.32 |
| IUPAC Name | tert-butyl 3-[(1,4-dimethoxynaphthalen-2-yl)methoxy]-4-[4-(4-phenylbut-3-enoxy)phenyl]piperidine-1-carboxylate |
| SMILES | COc1cc(COC2CN(C(=O)OC(C)(C)C)CCC2c2ccc(OCCC=Cc3ccccc3)cc2)c(OC)c2ccccc12 |
| InChI | InChI=1S/C39H45NO6/c1-39(2,3)46-38(41)40-23-22-32(29-18-20-31(21-19-29)44-24-12-11-15-28-13-7-6-8-14-28)36(26-40)45-27-30-25-35(42-4)33-16-9-10-17-34(33)37(30)43-5/h6-11,13-21,25,32,36H,12,22-24,26-27H2,1-5H3 |
| InChIKey | OQNXOGWPACFHKI-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.79 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|