C37H41NO7 — CID 86604407
tert-butyl 4-[4-[2-(4-methoxybenzoyl)oxyethoxy]phenyl]-3-(naphthalen-2-ylmethoxy)piperidine-1-carboxylate (PubChem CID 86604407) has the molecular formula C37H41NO7 and a molecular weight of 611.74 g/mol. Its IUPAC name is tert-butyl 4-[4-[2-(4-methoxybenzoyl)oxyethoxy]phenyl]-3-(naphthalen-2-ylmethoxy)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[2-(4-methoxybenzoyl)oxyethoxy]phenyl]-3-(naphthalen-2-ylmethoxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 86604407 |
| Molecular Formula | C37H41NO7 |
| Molecular Weight | 611.74 g/mol |
| Exact Mass | 611.29 |
| IUPAC Name | tert-butyl 4-[4-[2-(4-methoxybenzoyl)oxyethoxy]phenyl]-3-(naphthalen-2-ylmethoxy)piperidine-1-carboxylate |
| SMILES | COc1ccc(C(=O)OCCOc2ccc(C3CCN(C(=O)OC(C)(C)C)CC3OCc3ccc4ccccc4c3)cc2)cc1 |
| InChI | InChI=1S/C37H41NO7/c1-37(2,3)45-36(40)38-20-19-33(34(24-38)44-25-26-9-10-27-7-5-6-8-30(27)23-26)28-11-17-32(18-12-28)42-21-22-43-35(39)29-13-15-31(41-4)16-14-29/h5-18,23,33-34H,19-22,24-25H2,1-4H3 |
| InChIKey | ZXCPVTUHINKBRK-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.74 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|