C29H36N2O5 — CID 57265518
tert-butyl (3R,4R)-4-[4-(3-hydroxypropoxy)phenyl]-3-(quinolin-7-ylmethoxy)piperidine-1-carboxylate (PubChem CID 57265518) has the molecular formula C29H36N2O5 and a molecular weight of 492.62 g/mol. Its IUPAC name is tert-butyl (3R,4R)-4-[4-(3-hydroxypropoxy)phenyl]-3-(quinolin-7-ylmethoxy)piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4R)-4-[4-(3-hydroxypropoxy)phenyl]-3-(quinolin-7-ylmethoxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 57265518 |
| Molecular Formula | C29H36N2O5 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.26 |
| IUPAC Name | tert-butyl (3R,4R)-4-[4-(3-hydroxypropoxy)phenyl]-3-(quinolin-7-ylmethoxy)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](c2ccc(OCCCO)cc2)[C@@H](OCc2ccc3cccnc3c2)C1 |
| InChI | InChI=1S/C29H36N2O5/c1-29(2,3)36-28(33)31-15-13-25(22-9-11-24(12-10-22)34-17-5-16-32)27(19-31)35-20-21-7-8-23-6-4-14-30-26(23)18-21/h4,6-12,14,18,25,27,32H,5,13,15-17,19-20H2,1-3H3/t25-,27+/m1/s1 |
| InChIKey | OGZOGFKVSISYQA-VPUSJEBWSA-N |
| XLogP | 5.31 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|