C34H37NO7 — CID 22126969
tert-butyl 4-[4-[2-(furan-3-carbonyloxy)ethoxy]phenyl]-3-(naphthalen-2-ylmethoxy)piperidine-1-carboxylate (PubChem CID 22126969) has the molecular formula C34H37NO7 and a molecular weight of 571.67 g/mol. Its IUPAC name is tert-butyl 4-[4-[2-(furan-3-carbonyloxy)ethoxy]phenyl]-3-(naphthalen-2-ylmethoxy)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[2-(furan-3-carbonyloxy)ethoxy]phenyl]-3-(naphthalen-2-ylmethoxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 22126969 |
| Molecular Formula | C34H37NO7 |
| Molecular Weight | 571.67 g/mol |
| Exact Mass | 571.26 |
| IUPAC Name | tert-butyl 4-[4-[2-(furan-3-carbonyloxy)ethoxy]phenyl]-3-(naphthalen-2-ylmethoxy)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccc(OCCOC(=O)c3ccoc3)cc2)C(OCc2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C34H37NO7/c1-34(2,3)42-33(37)35-16-14-30(31(21-35)41-22-24-8-9-25-6-4-5-7-27(25)20-24)26-10-12-29(13-11-26)39-18-19-40-32(36)28-15-17-38-23-28/h4-13,15,17,20,23,30-31H,14,16,18-19,21-22H2,1-3H3 |
| InChIKey | KSZPQEALSOKOGD-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 87.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.67 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|