C24H23FNO4- — CID 22127874
4-(4-fluorophenyl)-3-[(1-methoxynaphthalen-2-yl)methoxy]piperidine-1-carboxylate (PubChem CID 22127874) has the molecular formula C24H23FNO4- and a molecular weight of 408.45 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-3-[(1-methoxynaphthalen-2-yl)methoxy]piperidine-1-carboxylate.
| Compound Name | 4-(4-fluorophenyl)-3-[(1-methoxynaphthalen-2-yl)methoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 22127874 |
| Molecular Formula | C24H23FNO4- |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 4-(4-fluorophenyl)-3-[(1-methoxynaphthalen-2-yl)methoxy]piperidine-1-carboxylate |
| SMILES | COc1c(COC2CN(C(=O)[O-])CCC2c2ccc(F)cc2)ccc2ccccc12 |
| InChI | InChI=1S/C24H24FNO4/c1-29-23-18(7-6-16-4-2-3-5-21(16)23)15-30-22-14-26(24(27)28)13-12-20(22)17-8-10-19(25)11-9-17/h2-11,20,22H,12-15H2,1H3,(H,27,28)/p-1 |
| InChIKey | SEDFKIHVEDFLGY-UHFFFAOYSA-M |
| XLogP | 3.71 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |