C20H21FNO4S- — CID 22127028
4-(4-fluorophenyl)-3-[(4-methylsulfinylphenyl)methoxy]piperidine-1-carboxylate (PubChem CID 22127028) has the molecular formula C20H21FNO4S- and a molecular weight of 390.46 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-3-[(4-methylsulfinylphenyl)methoxy]piperidine-1-carboxylate.
| Compound Name | 4-(4-fluorophenyl)-3-[(4-methylsulfinylphenyl)methoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 22127028 |
| Molecular Formula | C20H21FNO4S- |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 4-(4-fluorophenyl)-3-[(4-methylsulfinylphenyl)methoxy]piperidine-1-carboxylate |
| SMILES | CS(=O)c1ccc(COC2CN(C(=O)[O-])CCC2c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C20H22FNO4S/c1-27(25)17-8-2-14(3-9-17)13-26-19-12-22(20(23)24)11-10-18(19)15-4-6-16(21)7-5-15/h2-9,18-19H,10-13H2,1H3,(H,23,24)/p-1 |
| InChIKey | WJXSSCILIOALSE-UHFFFAOYSA-M |
| XLogP | 2.28 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |