C29H35FNO5Si- — CID 22127455
4-(4-fluorophenyl)-3-[[1-(2-trimethylsilylethoxymethoxy)naphthalen-2-yl]methoxy]piperidine-1-carboxylate (PubChem CID 22127455) has the molecular formula C29H35FNO5Si- and a molecular weight of 524.69 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-3-[[1-(2-trimethylsilylethoxymethoxy)naphthalen-2-yl]methoxy]piperidine-1-carboxylate.
| Compound Name | 4-(4-fluorophenyl)-3-[[1-(2-trimethylsilylethoxymethoxy)naphthalen-2-yl]methoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 22127455 |
| Molecular Formula | C29H35FNO5Si- |
| Molecular Weight | 524.69 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | 4-(4-fluorophenyl)-3-[[1-(2-trimethylsilylethoxymethoxy)naphthalen-2-yl]methoxy]piperidine-1-carboxylate |
| SMILES | C[Si](C)(C)CCOCOc1c(COC2CN(C(=O)[O-])CCC2c2ccc(F)cc2)ccc2ccccc12 |
| InChI | InChI=1S/C29H36FNO5Si/c1-37(2,3)17-16-34-20-36-28-23(9-8-21-6-4-5-7-26(21)28)19-35-27-18-31(29(32)33)15-14-25(27)22-10-12-24(30)13-11-22/h4-13,25,27H,14-20H2,1-3H3,(H,32,33)/p-1 |
| InChIKey | CJMQZKBIAOXELJ-UHFFFAOYSA-M |
| XLogP | 5.39 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.69 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|