C23H22FNO4 — CID 22128461
4-(4-fluorophenyl)-3-[(1-hydroxynaphthalen-2-yl)methoxy]piperidine-1-carboxylic acid (PubChem CID 22128461) has the molecular formula C23H22FNO4 and a molecular weight of 395.43 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-3-[(1-hydroxynaphthalen-2-yl)methoxy]piperidine-1-carboxylic acid.
| Compound Name | 4-(4-fluorophenyl)-3-[(1-hydroxynaphthalen-2-yl)methoxy]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 22128461 |
| Molecular Formula | C23H22FNO4 |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 4-(4-fluorophenyl)-3-[(1-hydroxynaphthalen-2-yl)methoxy]piperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC(c2ccc(F)cc2)C(OCc2ccc3ccccc3c2O)C1 |
| InChI | InChI=1S/C23H22FNO4/c24-18-9-7-16(8-10-18)19-11-12-25(23(27)28)13-21(19)29-14-17-6-5-15-3-1-2-4-20(15)22(17)26/h1-10,19,21,26H,11-14H2,(H,27,28) |
| InChIKey | ZWAFVCGXLVUNKD-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |