C35H39NO6S — CID 22128925
4-[4-(3-benzylsulfanylpropoxy)phenyl]-3-[(4,8-dimethoxynaphthalen-2-yl)methoxy]piperidine-1-carboxylic acid (PubChem CID 22128925) has the molecular formula C35H39NO6S and a molecular weight of 601.77 g/mol. Its IUPAC name is 4-[4-(3-benzylsulfanylpropoxy)phenyl]-3-[(4,8-dimethoxynaphthalen-2-yl)methoxy]piperidine-1-carboxylic acid.
| Compound Name | 4-[4-(3-benzylsulfanylpropoxy)phenyl]-3-[(4,8-dimethoxynaphthalen-2-yl)methoxy]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 22128925 |
| Molecular Formula | C35H39NO6S |
| Molecular Weight | 601.77 g/mol |
| Exact Mass | 601.25 |
| IUPAC Name | 4-[4-(3-benzylsulfanylpropoxy)phenyl]-3-[(4,8-dimethoxynaphthalen-2-yl)methoxy]piperidine-1-carboxylic acid |
| SMILES | COc1cc(COC2CN(C(=O)O)CCC2c2ccc(OCCCSCc3ccccc3)cc2)cc2c(OC)cccc12 |
| InChI | InChI=1S/C35H39NO6S/c1-39-32-11-6-10-30-31(32)20-26(21-33(30)40-2)23-42-34-22-36(35(37)38)17-16-29(34)27-12-14-28(15-13-27)41-18-7-19-43-24-25-8-4-3-5-9-25/h3-6,8-15,20-21,29,34H,7,16-19,22-24H2,1-2H3,(H,37,38) |
| InChIKey | SVWVAICADNCIGJ-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.77 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|