C30H35BrN2O6 — CID 68504129
3-[(3-amino-4-bromophenyl)methoxy]-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidine-1-carboxylic acid (PubChem CID 68504129) has the molecular formula C30H35BrN2O6 and a molecular weight of 599.52 g/mol. Its IUPAC name is 3-[(3-amino-4-bromophenyl)methoxy]-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidine-1-carboxylic acid.
| Compound Name | 3-[(3-amino-4-bromophenyl)methoxy]-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 68504129 |
| Molecular Formula | C30H35BrN2O6 |
| Molecular Weight | 599.52 g/mol |
| Exact Mass | 598.17 |
| IUPAC Name | 3-[(3-amino-4-bromophenyl)methoxy]-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidine-1-carboxylic acid |
| SMILES | COc1ccccc1COCCCOc1ccc(C2CCN(C(=O)O)CC2OCc2ccc(Br)c(N)c2)cc1 |
| InChI | InChI=1S/C30H35BrN2O6/c1-36-28-6-3-2-5-23(28)20-37-15-4-16-38-24-10-8-22(9-11-24)25-13-14-33(30(34)35)18-29(25)39-19-21-7-12-26(31)27(32)17-21/h2-3,5-12,17,25,29H,4,13-16,18-20,32H2,1H3,(H,34,35) |
| InChIKey | DAIXOLBBQPFGCW-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 103.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.52 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|