C37H40N2O8 — CID 68572892
benzyl 4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]-3-[(3-nitrophenyl)methoxy]piperidine-1-carboxylate (PubChem CID 68572892) has the molecular formula C37H40N2O8 and a molecular weight of 640.73 g/mol. Its IUPAC name is benzyl 4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]-3-[(3-nitrophenyl)methoxy]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]-3-[(3-nitrophenyl)methoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 68572892 |
| Molecular Formula | C37H40N2O8 |
| Molecular Weight | 640.73 g/mol |
| Exact Mass | 640.28 |
| IUPAC Name | benzyl 4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]-3-[(3-nitrophenyl)methoxy]piperidine-1-carboxylate |
| SMILES | COc1ccccc1COCCCOc1ccc(C2CCN(C(=O)OCc3ccccc3)CC2OCc2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C37H40N2O8/c1-43-35-14-6-5-12-31(35)27-44-21-8-22-45-33-17-15-30(16-18-33)34-19-20-38(37(40)47-25-28-9-3-2-4-10-28)24-36(34)46-26-29-11-7-13-32(23-29)39(41)42/h2-7,9-18,23,34,36H,8,19-22,24-27H2,1H3 |
| InChIKey | WPHQFDMTYBAOPH-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 109.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.73 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|