C43H50N2O7 — CID 68502154
benzyl 3-[1-(1H-indol-6-yl)-4-methoxybutoxy]-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidine-1-carboxylate (PubChem CID 68502154) has the molecular formula C43H50N2O7 and a molecular weight of 706.88 g/mol. Its IUPAC name is benzyl 3-[1-(1H-indol-6-yl)-4-methoxybutoxy]-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidine-1-carboxylate.
| Compound Name | benzyl 3-[1-(1H-indol-6-yl)-4-methoxybutoxy]-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 68502154 |
| Molecular Formula | C43H50N2O7 |
| Molecular Weight | 706.88 g/mol |
| Exact Mass | 706.36 |
| IUPAC Name | benzyl 3-[1-(1H-indol-6-yl)-4-methoxybutoxy]-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidine-1-carboxylate |
| SMILES | COCCCC(OC1CN(C(=O)OCc2ccccc2)CCC1c1ccc(OCCCOCc2ccccc2OC)cc1)c1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C43H50N2O7/c1-47-25-8-14-41(35-16-15-34-21-23-44-39(34)28-35)52-42-29-45(43(46)51-30-32-10-4-3-5-11-32)24-22-38(42)33-17-19-37(20-18-33)50-27-9-26-49-31-36-12-6-7-13-40(36)48-2/h3-7,10-13,15-21,23,28,38,41-42,44H,8-9,14,22,24-27,29-31H2,1-2H3 |
| InChIKey | JKRYECYFCPPWAN-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.88 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|