C37H39BrN2O8 — CID 68502204
benzyl 3-[(2-bromo-3-nitrophenyl)methoxy]-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidine-1-carboxylate (PubChem CID 68502204) has the molecular formula C37H39BrN2O8 and a molecular weight of 719.63 g/mol. Its IUPAC name is benzyl 3-[(2-bromo-3-nitrophenyl)methoxy]-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidine-1-carboxylate.
| Compound Name | benzyl 3-[(2-bromo-3-nitrophenyl)methoxy]-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 68502204 |
| Molecular Formula | C37H39BrN2O8 |
| Molecular Weight | 719.63 g/mol |
| Exact Mass | 718.19 |
| IUPAC Name | benzyl 3-[(2-bromo-3-nitrophenyl)methoxy]-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidine-1-carboxylate |
| SMILES | COc1ccccc1COCCCOc1ccc(C2CCN(C(=O)OCc3ccccc3)CC2OCc2cccc([N+](=O)[O-])c2Br)cc1 |
| InChI | InChI=1S/C37H39BrN2O8/c1-44-34-14-6-5-11-29(34)25-45-21-8-22-46-31-17-15-28(16-18-31)32-19-20-39(37(41)48-24-27-9-3-2-4-10-27)23-35(32)47-26-30-12-7-13-33(36(30)38)40(42)43/h2-7,9-18,32,35H,8,19-26H2,1H3 |
| InChIKey | IKWZWOFGEZIFDL-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 109.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.63 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|