C32H39NO9S — CID 87477853
4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]-3-[2-(4-methylphenyl)sulfonyloxyethoxy]piperidine-1-carboxylic acid (PubChem CID 87477853) has the molecular formula C32H39NO9S and a molecular weight of 613.73 g/mol. Its IUPAC name is 4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]-3-[2-(4-methylphenyl)sulfonyloxyethoxy]piperidine-1-carboxylic acid.
| Compound Name | 4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]-3-[2-(4-methylphenyl)sulfonyloxyethoxy]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 87477853 |
| Molecular Formula | C32H39NO9S |
| Molecular Weight | 613.73 g/mol |
| Exact Mass | 613.23 |
| IUPAC Name | 4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]-3-[2-(4-methylphenyl)sulfonyloxyethoxy]piperidine-1-carboxylic acid |
| SMILES | COc1ccccc1COCCCOc1ccc(C2CCN(C(=O)O)CC2OCCOS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C32H39NO9S/c1-24-8-14-28(15-9-24)43(36,37)42-21-20-41-31-22-33(32(34)35)17-16-29(31)25-10-12-27(13-11-25)40-19-5-18-39-23-26-6-3-4-7-30(26)38-2/h3-4,6-15,29,31H,5,16-23H2,1-2H3,(H,34,35) |
| InChIKey | XYAQCLDQRCFYDT-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 120.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.73 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|