C35H44N2O9 — CID 90948563
3-[2-[2-[3-(hydroxymethylamino)-3-oxopropyl]phenoxy]ethoxy]-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidine-1-carboxylic acid (PubChem CID 90948563) has the molecular formula C35H44N2O9 and a molecular weight of 636.74 g/mol. Its IUPAC name is 3-[2-[2-[3-(hydroxymethylamino)-3-oxopropyl]phenoxy]ethoxy]-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidine-1-carboxylic acid.
| Compound Name | 3-[2-[2-[3-(hydroxymethylamino)-3-oxopropyl]phenoxy]ethoxy]-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 90948563 |
| Molecular Formula | C35H44N2O9 |
| Molecular Weight | 636.74 g/mol |
| Exact Mass | 636.30 |
| IUPAC Name | 3-[2-[2-[3-(hydroxymethylamino)-3-oxopropyl]phenoxy]ethoxy]-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidine-1-carboxylic acid |
| SMILES | COc1ccccc1COCCCOc1ccc(C2CCN(C(=O)O)CC2OCCOc2ccccc2CCC(=O)NCO)cc1 |
| InChI | InChI=1S/C35H44N2O9/c1-42-31-9-4-3-8-28(31)24-43-19-6-20-44-29-14-11-26(12-15-29)30-17-18-37(35(40)41)23-33(30)46-22-21-45-32-10-5-2-7-27(32)13-16-34(39)36-25-38/h2-5,7-12,14-15,30,33,38H,6,13,16-25H2,1H3,(H,36,39)(H,40,41) |
| InChIKey | CQZTZFZNNYEHGV-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 136.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.74 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|