C30H35N2O5- — CID 22128440
4-[4-(3-morpholin-4-ylpropoxy)phenyl]-3-(naphthalen-2-ylmethoxy)piperidine-1-carboxylate (PubChem CID 22128440) has the molecular formula C30H35N2O5- and a molecular weight of 503.62 g/mol. Its IUPAC name is 4-[4-(3-morpholin-4-ylpropoxy)phenyl]-3-(naphthalen-2-ylmethoxy)piperidine-1-carboxylate.
| Compound Name | 4-[4-(3-morpholin-4-ylpropoxy)phenyl]-3-(naphthalen-2-ylmethoxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 22128440 |
| Molecular Formula | C30H35N2O5- |
| Molecular Weight | 503.62 g/mol |
| Exact Mass | 503.26 |
| IUPAC Name | 4-[4-(3-morpholin-4-ylpropoxy)phenyl]-3-(naphthalen-2-ylmethoxy)piperidine-1-carboxylate |
| SMILES | O=C([O-])N1CCC(c2ccc(OCCCN3CCOCC3)cc2)C(OCc2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C30H36N2O5/c33-30(34)32-14-12-28(29(21-32)37-22-23-6-7-24-4-1-2-5-26(24)20-23)25-8-10-27(11-9-25)36-17-3-13-31-15-18-35-19-16-31/h1-2,4-11,20,28-29H,3,12-19,21-22H2,(H,33,34)/p-1 |
| InChIKey | DSYKCTRABMVCRH-UHFFFAOYSA-M |
| XLogP | 3.66 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.62 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|