C33H34NO6S- — CID 22128118
3-(1-benzothiophen-5-ylmethoxy)-4-[4-[3-(2-phenyl-1,3-dioxolan-2-yl)propoxy]phenyl]piperidine-1-carboxylate (PubChem CID 22128118) has the molecular formula C33H34NO6S- and a molecular weight of 572.70 g/mol. Its IUPAC name is 3-(1-benzothiophen-5-ylmethoxy)-4-[4-[3-(2-phenyl-1,3-dioxolan-2-yl)propoxy]phenyl]piperidine-1-carboxylate.
| Compound Name | 3-(1-benzothiophen-5-ylmethoxy)-4-[4-[3-(2-phenyl-1,3-dioxolan-2-yl)propoxy]phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 22128118 |
| Molecular Formula | C33H34NO6S- |
| Molecular Weight | 572.70 g/mol |
| Exact Mass | 572.21 |
| IUPAC Name | 3-(1-benzothiophen-5-ylmethoxy)-4-[4-[3-(2-phenyl-1,3-dioxolan-2-yl)propoxy]phenyl]piperidine-1-carboxylate |
| SMILES | O=C([O-])N1CCC(c2ccc(OCCCC3(c4ccccc4)OCCO3)cc2)C(OCc2ccc3sccc3c2)C1 |
| InChI | InChI=1S/C33H35NO6S/c35-32(36)34-16-13-29(30(22-34)38-23-24-7-12-31-26(21-24)14-20-41-31)25-8-10-28(11-9-25)37-17-4-15-33(39-18-19-40-33)27-5-2-1-3-6-27/h1-3,5-12,14,20-21,29-30H,4,13,15-19,22-23H2,(H,35,36)/p-1 |
| InChIKey | FESAWNSSEYURSC-UHFFFAOYSA-M |
| XLogP | 5.68 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.70 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|