C29H26N3O5- — CID 22126356
3-(naphthalen-2-ylmethoxy)-4-[4-(pyridin-2-ylcarbamoyloxy)phenyl]piperidine-1-carboxylate (PubChem CID 22126356) has the molecular formula C29H26N3O5- and a molecular weight of 496.54 g/mol. Its IUPAC name is 3-(naphthalen-2-ylmethoxy)-4-[4-(pyridin-2-ylcarbamoyloxy)phenyl]piperidine-1-carboxylate.
| Compound Name | 3-(naphthalen-2-ylmethoxy)-4-[4-(pyridin-2-ylcarbamoyloxy)phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 22126356 |
| Molecular Formula | C29H26N3O5- |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 3-(naphthalen-2-ylmethoxy)-4-[4-(pyridin-2-ylcarbamoyloxy)phenyl]piperidine-1-carboxylate |
| SMILES | O=C(Nc1ccccn1)Oc1ccc(C2CCN(C(=O)[O-])CC2OCc2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C29H27N3O5/c33-28(31-27-7-3-4-15-30-27)37-24-12-10-22(11-13-24)25-14-16-32(29(34)35)18-26(25)36-19-20-8-9-21-5-1-2-6-23(21)17-20/h1-13,15,17,25-26H,14,16,18-19H2,(H,34,35)(H,30,31,33)/p-1 |
| InChIKey | KBKGNPFNQYJEOJ-UHFFFAOYSA-M |
| XLogP | 4.56 |
| TPSA | 103.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |