C32H35N4O4- — CID 22128269
4-[2-[methyl(3-phenylmethoxypropyl)amino]pyrimidin-5-yl]-3-(naphthalen-2-ylmethoxy)piperidine-1-carboxylate (PubChem CID 22128269) has the molecular formula C32H35N4O4- and a molecular weight of 539.66 g/mol. Its IUPAC name is 4-[2-[methyl(3-phenylmethoxypropyl)amino]pyrimidin-5-yl]-3-(naphthalen-2-ylmethoxy)piperidine-1-carboxylate.
| Compound Name | 4-[2-[methyl(3-phenylmethoxypropyl)amino]pyrimidin-5-yl]-3-(naphthalen-2-ylmethoxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 22128269 |
| Molecular Formula | C32H35N4O4- |
| Molecular Weight | 539.66 g/mol |
| Exact Mass | 539.27 |
| IUPAC Name | 4-[2-[methyl(3-phenylmethoxypropyl)amino]pyrimidin-5-yl]-3-(naphthalen-2-ylmethoxy)piperidine-1-carboxylate |
| SMILES | CN(CCCOCc1ccccc1)c1ncc(C2CCN(C(=O)[O-])CC2OCc2ccc3ccccc3c2)cn1 |
| InChI | InChI=1S/C32H36N4O4/c1-35(15-7-17-39-22-24-8-3-2-4-9-24)31-33-19-28(20-34-31)29-14-16-36(32(37)38)21-30(29)40-23-25-12-13-26-10-5-6-11-27(26)18-25/h2-6,8-13,18-20,29-30H,7,14-17,21-23H2,1H3,(H,37,38)/p-1 |
| InChIKey | HVGXLAVMGMIYNH-UHFFFAOYSA-M |
| XLogP | 4.39 |
| TPSA | 90.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.66 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|