C37H40N2O7 — CID 172953739
3-[(2Z)-2-(2-methoxy-2-oxoethoxy)imino-2-naphthalen-2-ylethyl]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine-1-carboxylic acid (PubChem CID 172953739) has the molecular formula C37H40N2O7 and a molecular weight of 624.73 g/mol. Its IUPAC name is 3-[(2Z)-2-(2-methoxy-2-oxoethoxy)imino-2-naphthalen-2-ylethyl]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine-1-carboxylic acid.
| Compound Name | 3-[(2Z)-2-(2-methoxy-2-oxoethoxy)imino-2-naphthalen-2-ylethyl]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 172953739 |
| Molecular Formula | C37H40N2O7 |
| Molecular Weight | 624.73 g/mol |
| Exact Mass | 624.28 |
| IUPAC Name | 3-[(2Z)-2-(2-methoxy-2-oxoethoxy)imino-2-naphthalen-2-ylethyl]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine-1-carboxylic acid |
| SMILES | COC(=O)CO/N=C(/CC1CN(C(=O)O)CCC1c1ccc(OCCCOCc2ccccc2)cc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C37H40N2O7/c1-43-36(40)26-46-38-35(31-13-12-28-10-5-6-11-30(28)22-31)23-32-24-39(37(41)42)19-18-34(32)29-14-16-33(17-15-29)45-21-7-20-44-25-27-8-3-2-4-9-27/h2-6,8-17,22,32,34H,7,18-21,23-26H2,1H3,(H,41,42)/b38-35- |
| InChIKey | SFTMIQUSSZUPJX-DIGXQUICSA-N |
| XLogP | 6.89 |
| TPSA | 106.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.73 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|