C29H33FNO4Si — CID 174445548
CID 174445548 (PubChem CID 174445548) has the molecular formula C29H33FNO4Si and a molecular weight of 506.67 g/mol.
| Compound Name | CID 174445548 |
|---|---|
| PubChem CID | 174445548 |
| Molecular Formula | C29H33FNO4Si |
| Molecular Weight | 506.67 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | — |
| SMILES | COc1ccc2ccc(COC3CN(C(=O)OC(C)(C)C(C)[Si])CCC3c3ccc(F)cc3)cc2c1 |
| InChI | InChI=1S/C29H33FNO4Si/c1-19(36)29(2,3)35-28(32)31-14-13-26(22-7-10-24(30)11-8-22)27(17-31)34-18-20-5-6-21-9-12-25(33-4)16-23(21)15-20/h5-12,15-16,19,26-27H,13-14,17-18H2,1-4H3 |
| InChIKey | CVPNFWKWEDVKMS-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.67 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|