C21H34N2O3 — CID 2784683
tert-butyl 4-[4-(phenylmethoxyamino)butyl]piperidine-1-carboxylate (PubChem CID 2784683) has the molecular formula C21H34N2O3 and a molecular weight of 362.51 g/mol. Its IUPAC name is tert-butyl 4-[4-(phenylmethoxyamino)butyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(phenylmethoxyamino)butyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 2784683 |
| Molecular Formula | C21H34N2O3 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | tert-butyl 4-[4-(phenylmethoxyamino)butyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CCCCNOCc2ccccc2)CC1 |
| InChI | InChI=1S/C21H34N2O3/c1-21(2,3)26-20(24)23-15-12-18(13-16-23)9-7-8-14-22-25-17-19-10-5-4-6-11-19/h4-6,10-11,18,22H,7-9,12-17H2,1-3H3 |
| InChIKey | CAGHBQBCQVDHLL-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|