C18H26BrNO2 — CID 58306239
benzyl 4-(5-bromopentyl)piperidine-1-carboxylate (PubChem CID 58306239) has the molecular formula C18H26BrNO2 and a molecular weight of 368.32 g/mol. Its IUPAC name is benzyl 4-(5-bromopentyl)piperidine-1-carboxylate.
| Compound Name | benzyl 4-(5-bromopentyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58306239 |
| Molecular Formula | C18H26BrNO2 |
| Molecular Weight | 368.32 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | benzyl 4-(5-bromopentyl)piperidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCC(CCCCCBr)CC1 |
| InChI | InChI=1S/C18H26BrNO2/c19-12-6-2-5-7-16-10-13-20(14-11-16)18(21)22-15-17-8-3-1-4-9-17/h1,3-4,8-9,16H,2,5-7,10-15H2 |
| InChIKey | CVIFAVLNFMKESF-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.32 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|