C26H40N2O5 — CID 166066118
tert-butyl 4-[3-(1-phenylmethoxycarbonylpiperidin-4-yl)oxypropyl]piperidine-1-carboxylate (PubChem CID 166066118) has the molecular formula C26H40N2O5 and a molecular weight of 460.62 g/mol. Its IUPAC name is tert-butyl 4-[3-(1-phenylmethoxycarbonylpiperidin-4-yl)oxypropyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(1-phenylmethoxycarbonylpiperidin-4-yl)oxypropyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166066118 |
| Molecular Formula | C26H40N2O5 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.29 |
| IUPAC Name | tert-butyl 4-[3-(1-phenylmethoxycarbonylpiperidin-4-yl)oxypropyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CCCOC2CCN(C(=O)OCc3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C26H40N2O5/c1-26(2,3)33-25(30)28-15-11-21(12-16-28)10-7-19-31-23-13-17-27(18-14-23)24(29)32-20-22-8-5-4-6-9-22/h4-6,8-9,21,23H,7,10-20H2,1-3H3 |
| InChIKey | ONODQZPCCCZJLA-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|