C23H35NO2S2 — CID 167631664
benzyl 4-[2-(2-cyclohexylethyldisulfanyl)ethyl]piperidine-1-carboxylate (PubChem CID 167631664) has the molecular formula C23H35NO2S2 and a molecular weight of 421.67 g/mol. Its IUPAC name is benzyl 4-[2-(2-cyclohexylethyldisulfanyl)ethyl]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[2-(2-cyclohexylethyldisulfanyl)ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 167631664 |
| Molecular Formula | C23H35NO2S2 |
| Molecular Weight | 421.67 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | benzyl 4-[2-(2-cyclohexylethyldisulfanyl)ethyl]piperidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCC(CCSSCCC2CCCCC2)CC1 |
| InChI | InChI=1S/C23H35NO2S2/c25-23(26-19-22-9-5-2-6-10-22)24-15-11-21(12-16-24)14-18-28-27-17-13-20-7-3-1-4-8-20/h2,5-6,9-10,20-21H,1,3-4,7-8,11-19H2 |
| InChIKey | NWUUSKBUZQJPRB-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.67 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|