C20H31NO5S — CID 166066093
tert-butyl 4-(3-benzylsulfonyloxypropyl)piperidine-1-carboxylate (PubChem CID 166066093) has the molecular formula C20H31NO5S and a molecular weight of 397.54 g/mol. Its IUPAC name is tert-butyl 4-(3-benzylsulfonyloxypropyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(3-benzylsulfonyloxypropyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166066093 |
| Molecular Formula | C20H31NO5S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | tert-butyl 4-(3-benzylsulfonyloxypropyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CCCOS(=O)(=O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H31NO5S/c1-20(2,3)26-19(22)21-13-11-17(12-14-21)10-7-15-25-27(23,24)16-18-8-5-4-6-9-18/h4-6,8-9,17H,7,10-16H2,1-3H3 |
| InChIKey | IKPXNHUYUCLOAN-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|