C31H44N2O7S — CID 10371164
tert-butyl 4-[4-[4-[(2S)-2-(benzylsulfonylamino)-3-methoxy-3-oxopropyl]phenoxy]butyl]piperidine-1-carboxylate (PubChem CID 10371164) has the molecular formula C31H44N2O7S and a molecular weight of 588.77 g/mol. Its IUPAC name is tert-butyl 4-[4-[4-[(2S)-2-(benzylsulfonylamino)-3-methoxy-3-oxopropyl]phenoxy]butyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[4-[(2S)-2-(benzylsulfonylamino)-3-methoxy-3-oxopropyl]phenoxy]butyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 10371164 |
| Molecular Formula | C31H44N2O7S |
| Molecular Weight | 588.77 g/mol |
| Exact Mass | 588.29 |
| IUPAC Name | tert-butyl 4-[4-[4-[(2S)-2-(benzylsulfonylamino)-3-methoxy-3-oxopropyl]phenoxy]butyl]piperidine-1-carboxylate |
| SMILES | COC(=O)[C@H](Cc1ccc(OCCCCC2CCN(C(=O)OC(C)(C)C)CC2)cc1)NS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C31H44N2O7S/c1-31(2,3)40-30(35)33-19-17-24(18-20-33)10-8-9-21-39-27-15-13-25(14-16-27)22-28(29(34)38-4)32-41(36,37)23-26-11-6-5-7-12-26/h5-7,11-16,24,28,32H,8-10,17-23H2,1-4H3/t28-/m0/s1 |
| InChIKey | IMTZUWWOKYSMOF-NDEPHWFRSA-N |
| XLogP | 5.09 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.77 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|