C30H42N2O7S — CID 70044479
tert-butyl 4-[4-[4-[2-(benzenesulfonamido)-3-methoxy-3-oxopropyl]phenoxy]butyl]piperidine-1-carboxylate (PubChem CID 70044479) has the molecular formula C30H42N2O7S and a molecular weight of 574.74 g/mol. Its IUPAC name is tert-butyl 4-[4-[4-[2-(benzenesulfonamido)-3-methoxy-3-oxopropyl]phenoxy]butyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[4-[2-(benzenesulfonamido)-3-methoxy-3-oxopropyl]phenoxy]butyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 70044479 |
| Molecular Formula | C30H42N2O7S |
| Molecular Weight | 574.74 g/mol |
| Exact Mass | 574.27 |
| IUPAC Name | tert-butyl 4-[4-[4-[2-(benzenesulfonamido)-3-methoxy-3-oxopropyl]phenoxy]butyl]piperidine-1-carboxylate |
| SMILES | COC(=O)C(Cc1ccc(OCCCCC2CCN(C(=O)OC(C)(C)C)CC2)cc1)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C30H42N2O7S/c1-30(2,3)39-29(34)32-19-17-23(18-20-32)10-8-9-21-38-25-15-13-24(14-16-25)22-27(28(33)37-4)31-40(35,36)26-11-6-5-7-12-26/h5-7,11-16,23,27,31H,8-10,17-22H2,1-4H3 |
| InChIKey | ZQMZJUMSLUTRMM-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.74 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|