C32H44N2O7 — CID 10008161
tert-butyl 4-[3-[4-[(2S)-4-methoxy-4-oxo-2-(phenylmethoxycarbonylamino)butyl]phenoxy]propyl]piperidine-1-carboxylate (PubChem CID 10008161) has the molecular formula C32H44N2O7 and a molecular weight of 568.71 g/mol. Its IUPAC name is tert-butyl 4-[3-[4-[(2S)-4-methoxy-4-oxo-2-(phenylmethoxycarbonylamino)butyl]phenoxy]propyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[4-[(2S)-4-methoxy-4-oxo-2-(phenylmethoxycarbonylamino)butyl]phenoxy]propyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 10008161 |
| Molecular Formula | C32H44N2O7 |
| Molecular Weight | 568.71 g/mol |
| Exact Mass | 568.31 |
| IUPAC Name | tert-butyl 4-[3-[4-[(2S)-4-methoxy-4-oxo-2-(phenylmethoxycarbonylamino)butyl]phenoxy]propyl]piperidine-1-carboxylate |
| SMILES | COC(=O)C[C@H](Cc1ccc(OCCCC2CCN(C(=O)OC(C)(C)C)CC2)cc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H44N2O7/c1-32(2,3)41-31(37)34-18-16-24(17-19-34)11-8-20-39-28-14-12-25(13-15-28)21-27(22-29(35)38-4)33-30(36)40-23-26-9-6-5-7-10-26/h5-7,9-10,12-15,24,27H,8,11,16-23H2,1-4H3,(H,33,36)/t27-/m0/s1 |
| InChIKey | WOVPUVJGLNWRJL-MHZLTWQESA-N |
| XLogP | 5.89 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.71 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|