C23H33NO6 — CID 58474180
4-O-benzyl 1-O-methyl (2R)-2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]methyl]butanedioate (PubChem CID 58474180) has the molecular formula C23H33NO6 and a molecular weight of 419.52 g/mol. Its IUPAC name is 4-O-benzyl 1-O-methyl (2R)-2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]methyl]butanedioate.
| Compound Name | 4-O-benzyl 1-O-methyl (2R)-2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]methyl]butanedioate |
|---|---|
| PubChem CID | 58474180 |
| Molecular Formula | C23H33NO6 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | 4-O-benzyl 1-O-methyl (2R)-2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]methyl]butanedioate |
| SMILES | COC(=O)[C@@H](CC(=O)OCc1ccccc1)CC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C23H33NO6/c1-23(2,3)30-22(27)24-12-10-17(11-13-24)14-19(21(26)28-4)15-20(25)29-16-18-8-6-5-7-9-18/h5-9,17,19H,10-16H2,1-4H3/t19-/m1/s1 |
| InChIKey | ATTHXRGAFKZZPV-LJQANCHMSA-N |
| XLogP | 3.95 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|