C25H37NO6 — CID 58351846
4-O-benzyl 1-O-methyl (2R)-2-[[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexyl]methyl]butanedioate (PubChem CID 58351846) has the molecular formula C25H37NO6 and a molecular weight of 447.57 g/mol. Its IUPAC name is 4-O-benzyl 1-O-methyl (2R)-2-[[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexyl]methyl]butanedioate.
| Compound Name | 4-O-benzyl 1-O-methyl (2R)-2-[[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexyl]methyl]butanedioate |
|---|---|
| PubChem CID | 58351846 |
| Molecular Formula | C25H37NO6 |
| Molecular Weight | 447.57 g/mol |
| Exact Mass | 447.26 |
| IUPAC Name | 4-O-benzyl 1-O-methyl (2R)-2-[[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexyl]methyl]butanedioate |
| SMILES | COC(=O)[C@@H](CC(=O)OCc1ccccc1)CC1CCC(CNC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C25H37NO6/c1-25(2,3)32-24(29)26-16-19-12-10-18(11-13-19)14-21(23(28)30-4)15-22(27)31-17-20-8-6-5-7-9-20/h5-9,18-19,21H,10-17H2,1-4H3,(H,26,29)/t18?,19?,21-/m1/s1 |
| InChIKey | QNTSSRCOLFKLOM-GZNCHQMQSA-N |
| XLogP | 4.63 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.57 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|