C25H35NO6 — CID 58351860
4-O-benzyl 1-O-methyl (2E)-2-[[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexyl]methylidene]butanedioate (PubChem CID 58351860) has the molecular formula C25H35NO6 and a molecular weight of 445.56 g/mol. Its IUPAC name is 4-O-benzyl 1-O-methyl (2E)-2-[[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexyl]methylidene]butanedioate.
| Compound Name | 4-O-benzyl 1-O-methyl (2E)-2-[[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexyl]methylidene]butanedioate |
|---|---|
| PubChem CID | 58351860 |
| Molecular Formula | C25H35NO6 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | 4-O-benzyl 1-O-methyl (2E)-2-[[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexyl]methylidene]butanedioate |
| SMILES | COC(=O)/C(=C/C1CCC(CNC(=O)OC(C)(C)C)CC1)CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H35NO6/c1-25(2,3)32-24(29)26-16-19-12-10-18(11-13-19)14-21(23(28)30-4)15-22(27)31-17-20-8-6-5-7-9-20/h5-9,14,18-19H,10-13,15-17H2,1-4H3,(H,26,29)/b21-14+ |
| InChIKey | ZVUGQLRRZRWFIA-KGENOOAVSA-N |
| XLogP | 4.55 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|