C18H27NO5 — CID 153402053
benzyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate;3-methoxyprop-1-ene (PubChem CID 153402053) has the molecular formula C18H27NO5 and a molecular weight of 337.42 g/mol. Its IUPAC name is benzyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate;3-methoxyprop-1-ene.
| Compound Name | benzyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate;3-methoxyprop-1-ene |
|---|---|
| PubChem CID | 153402053 |
| Molecular Formula | C18H27NO5 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | benzyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate;3-methoxyprop-1-ene |
| SMILES | C=CCOC.CC(C)(C)OC(=O)NCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H19NO4.C4H8O/c1-14(2,3)19-13(17)15-9-12(16)18-10-11-7-5-4-6-8-11;1-3-4-5-2/h4-8H,9-10H2,1-3H3,(H,15,17);3H,1,4H2,2H3 |
| InChIKey | NFSMDSUWOWLNEH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|