C25H31NO4 — CID 154955613
benzyl (2S)-2-benzyl-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]pent-4-enoate (PubChem CID 154955613) has the molecular formula C25H31NO4 and a molecular weight of 409.53 g/mol. Its IUPAC name is benzyl (2S)-2-benzyl-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]pent-4-enoate.
| Compound Name | benzyl (2S)-2-benzyl-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]pent-4-enoate |
|---|---|
| PubChem CID | 154955613 |
| Molecular Formula | C25H31NO4 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | benzyl (2S)-2-benzyl-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]pent-4-enoate |
| SMILES | C=CC[C@@](CNC(=O)OC(C)(C)C)(Cc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H31NO4/c1-5-16-25(17-20-12-8-6-9-13-20,19-26-23(28)30-24(2,3)4)22(27)29-18-21-14-10-7-11-15-21/h5-15H,1,16-19H2,2-4H3,(H,26,28)/t25-/m0/s1 |
| InChIKey | RTOOWTRLESIBML-VWLOTQADSA-N |
| XLogP | 5.06 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|