C18H23F3N2O4 — CID 162772661
tert-butyl N-[[(2R)-2-phenylmethoxy-2-(trifluoromethyl)pent-4-enoyl]amino]carbamate (PubChem CID 162772661) has the molecular formula C18H23F3N2O4 and a molecular weight of 388.39 g/mol. Its IUPAC name is tert-butyl N-[[(2R)-2-phenylmethoxy-2-(trifluoromethyl)pent-4-enoyl]amino]carbamate.
| Compound Name | tert-butyl N-[[(2R)-2-phenylmethoxy-2-(trifluoromethyl)pent-4-enoyl]amino]carbamate |
|---|---|
| PubChem CID | 162772661 |
| Molecular Formula | C18H23F3N2O4 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | tert-butyl N-[[(2R)-2-phenylmethoxy-2-(trifluoromethyl)pent-4-enoyl]amino]carbamate |
| SMILES | C=CC[C@@](OCc1ccccc1)(C(=O)NNC(=O)OC(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C18H23F3N2O4/c1-5-11-17(18(19,20)21,26-12-13-9-7-6-8-10-13)14(24)22-23-15(25)27-16(2,3)4/h5-10H,1,11-12H2,2-4H3,(H,22,24)(H,23,25)/t17-/m1/s1 |
| InChIKey | NZGTZZRJBDQFDS-QGZVFWFLSA-N |
| XLogP | 3.64 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|