C16H19F3O3 — CID 162772865
ethyl 2-phenylmethoxy-2-(trifluoromethyl)hex-5-enoate (PubChem CID 162772865) has the molecular formula C16H19F3O3 and a molecular weight of 316.32 g/mol. Its IUPAC name is ethyl 2-phenylmethoxy-2-(trifluoromethyl)hex-5-enoate.
| Compound Name | ethyl 2-phenylmethoxy-2-(trifluoromethyl)hex-5-enoate |
|---|---|
| PubChem CID | 162772865 |
| Molecular Formula | C16H19F3O3 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | ethyl 2-phenylmethoxy-2-(trifluoromethyl)hex-5-enoate |
| SMILES | C=CCCC(OCc1ccccc1)(C(=O)OCC)C(F)(F)F |
| InChI | InChI=1S/C16H19F3O3/c1-3-5-11-15(16(17,18)19,14(20)21-4-2)22-12-13-9-7-6-8-10-13/h3,6-10H,1,4-5,11-12H2,2H3 |
| InChIKey | NYTRWBIDHUJXPE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|