C16H22O2 — CID 158520959
benzyl 3,3-dimethylhept-6-enoate (PubChem CID 158520959) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is benzyl 3,3-dimethylhept-6-enoate.
| Compound Name | benzyl 3,3-dimethylhept-6-enoate |
|---|---|
| PubChem CID | 158520959 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | benzyl 3,3-dimethylhept-6-enoate |
| SMILES | C=CCCC(C)(C)CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H22O2/c1-4-5-11-16(2,3)12-15(17)18-13-14-9-7-6-8-10-14/h4,6-10H,1,5,11-13H2,2-3H3 |
| InChIKey | PWPQENWETYZULV-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|