C33H48O4S2 — CID 20633601
benzyl 6-[3-(4,4-dimethyl-6-oxo-6-phenylmethoxyhexyl)sulfanylpropylsulfanyl]-3,3-dimethylhexanoate (PubChem CID 20633601) has the molecular formula C33H48O4S2 and a molecular weight of 572.88 g/mol. Its IUPAC name is benzyl 6-[3-(4,4-dimethyl-6-oxo-6-phenylmethoxyhexyl)sulfanylpropylsulfanyl]-3,3-dimethylhexanoate.
| Compound Name | benzyl 6-[3-(4,4-dimethyl-6-oxo-6-phenylmethoxyhexyl)sulfanylpropylsulfanyl]-3,3-dimethylhexanoate |
|---|---|
| PubChem CID | 20633601 |
| Molecular Formula | C33H48O4S2 |
| Molecular Weight | 572.88 g/mol |
| Exact Mass | 572.30 |
| IUPAC Name | benzyl 6-[3-(4,4-dimethyl-6-oxo-6-phenylmethoxyhexyl)sulfanylpropylsulfanyl]-3,3-dimethylhexanoate |
| SMILES | CC(C)(CCCSCCCSCCCC(C)(C)CC(=O)OCc1ccccc1)CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C33H48O4S2/c1-32(2,24-30(34)36-26-28-14-7-5-8-15-28)18-11-20-38-22-13-23-39-21-12-19-33(3,4)25-31(35)37-27-29-16-9-6-10-17-29/h5-10,14-17H,11-13,18-27H2,1-4H3 |
| InChIKey | KYQNAGRLHHTBEQ-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.88 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|